CAS 1183136-69-7 appears in our catalog under these names: 1,3-Dimethyl-5-(4-methyl-1h-pyrazol-1-yl)-1h-pyrazole-4-carboxylic acid, 95%, 1,3-Dimethyl-5-(4-methyl-1H-pyrazol-1-yl)-1H-pyrazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1,3-dimethyl-5-(4-methylpyrazol-1-yl)pyrazole-4-carboxylic acid (CAS 1183136-69-7) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: 1,3-dimethyl-5-(4-methylpyrazol-1-yl)pyrazole-4-carboxylic acid. InChIKey: OSTLIPJEMYVALT-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | 1,3-dimethyl-5-(4-methylpyrazol-1-yl)pyrazole-4-carboxylic acid |
| InChIKey | OSTLIPJEMYVALT-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)C2=C(C(=NN2C)C)C(=O)O |
Computed by PubChem (NCBI)