Methyl 2-bromo-4,6-difluorobenzoate, 95%
cas: 1379336-54-5 — see every product listed under this CAS number, including other names
Methyl 2-bromo-4,6-difluorobenzoate, 95% (CAS 1379336-54-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QK-5648-250mg |
| cas | 1379336-54-5 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Ambeed | 250mg | 626.25 Pln | |
| Ambeed | 1g | 1310.44 Pln | |
| Ambeed | 5g | 3674.50 Pln | |
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 2680.40 Pln | |
| Chemat | 10g | 4509.20 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 669.79 Pln | |
| BLDpharm | 1g | 1402.86 Pln | |
| BLDpharm | 5g | 3957.52 Pln | |
| BLDpharm | 10g | 6673.23 Pln | |
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 549.82 Pln | |
| Fluorochem | 1g | 1054.85 Pln | |
| Fluorochem | 5g | 2736.55 Pln | |
| Fluorochem | 10g | 4584.86 Pln | |
| Fluorochem | 25g | 8932.29 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 2-bromo-4,6-difluorobenzoate (CAS 1379336-54-5) is a chemical compound with the molecular formula C8H5BrF2O2 and a molecular weight of 251.02 g/mol. IUPAC name: methyl 2-bromo-4,6-difluorobenzoate. InChIKey: GFYBACALZQKFBI-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O2 |
|---|---|
| Molecular weight | 251.02 g/mol |
| IUPAC name | methyl 2-bromo-4,6-difluorobenzoate |
| InChIKey | GFYBACALZQKFBI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Br)F)F |
Computed by PubChem (NCBI)