Methyl 4-chloro-3-cyanobenzoate, 98%
cas: 181282-80-4 — see every product listed under this CAS number, including other names
Methyl 4-chloro-3-cyanobenzoate, 98% (CAS 181282-80-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A156463-250mg |
| cas | 181282-80-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 314.75 Pln | |
| Ambeed | 5g | 1271.50 Pln | |
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1264.40 Pln | |
| Chemat | 10g | 1912.40 Pln | |
| BLDpharm | 250mg | 219.95 Pln | |
| BLDpharm | 1g | 331.02 Pln | |
| BLDpharm | 5g | 1363.99 Pln | |
| BLDpharm | 10g | 2652.42 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 4-chloro-3-cyanobenzoate (CAS 181282-80-4) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: methyl 4-chloro-3-cyanobenzoate. InChIKey: RYYMSFBYYAYGOX-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | methyl 4-chloro-3-cyanobenzoate |
| InChIKey | RYYMSFBYYAYGOX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Cl)C#N |
Computed by PubChem (NCBI)