Products 181282-80-4
CAS 181282-80-4 appears in our catalog under these names: Methyl 4-chloro-3-cyanobenzoate, 95%, Methyl 4-chloro-3-cyanobenzoate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
Methyl 4-chloro-3-cyanobenzoate (CAS 181282-80-4) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: methyl 4-chloro-3-cyanobenzoate. InChIKey: RYYMSFBYYAYGOX-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | methyl 4-chloro-3-cyanobenzoate |
| InChIKey | RYYMSFBYYAYGOX-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)Cl)C#N |
Computed by PubChem (NCBI)