cas: 686747-51-3 — see every product listed under this CAS number, including other names
Methyl 5-nitro-1H-indole-3-carboxylate, 95%, 95% (CAS 686747-51-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11739D-100mg |
| cas | 686747-51-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 952.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-nitro-1H-indole-3-carboxylate (CAS 686747-51-3) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: methyl 5-nitro-1H-indole-3-carboxylate. InChIKey: MMDKJGMVXBELQV-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | methyl 5-nitro-1H-indole-3-carboxylate |
| InChIKey | MMDKJGMVXBELQV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CNC2=C1C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)