cas: 29682-14-2 — see every product listed under this CAS number, including other names
Methyl 5-nitropicolinate, 96% (CAS 29682-14-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603390-1G |
| cas | 29682-14-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 25g | 1851.45 Pln | |
| Fluorochem | 100g | 5204.44 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-nitropyridine-2-carboxylate (CAS 29682-14-2) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: methyl 5-nitropyridine-2-carboxylate. InChIKey: WBJDJRHSHXTRAT-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | methyl 5-nitropyridine-2-carboxylate |
| InChIKey | WBJDJRHSHXTRAT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)