cas: 1186310-78-0 — see every product listed under this CAS number, including other names
N-Methoxy-N,3-dimethyl-3H-imidazo[4,5-b]pyridine-6-carboxamide, ≥95%, ≥95% (CAS 1186310-78-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HEN0-50mg |
| cas | 1186310-78-0 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 520.40 Pln | |
| Chemat | 100mg | 914.00 Pln | |
| Chemat | 250mg | 1389.20 Pln | |
| Chemat | 1g | 4048.40 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
N-methoxy-N,3-dimethylimidazo[4,5-b]pyridine-6-carboxamide (CAS 1186310-78-0) is a chemical compound with the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. IUPAC name: N-methoxy-N,3-dimethylimidazo[4,5-b]pyridine-6-carboxamide. InChIKey: CVCSGAZQUBEXLJ-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O2 |
|---|---|
| Molecular weight | 220.23 g/mol |
| IUPAC name | N-methoxy-N,3-dimethylimidazo[4,5-b]pyridine-6-carboxamide |
| InChIKey | CVCSGAZQUBEXLJ-UHFFFAOYSA-N |
| SMILES | CN1C=NC2=C1N=CC(=C2)C(=O)N(C)OC |
Computed by PubChem (NCBI)