cas: 363-03-1 — see every product listed under this CAS number, including other names
Phenyl-1,4-benzoquinone, 97% (CAS 363-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F099630-1G |
| cas | 363-03-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 294.71 Pln | |
| Fluorochem | 5g | 409.25 Pln | |
| Fluorochem | 10g | 758.08 Pln | |
| Fluorochem | 25g | 1518.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-phenylcyclohexa-2,5-diene-1,4-dione (CAS 363-03-1) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 2-phenylcyclohexa-2,5-diene-1,4-dione. InChIKey: RLQZIECDMISZHS-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-phenylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | RLQZIECDMISZHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C=CC2=O |
Computed by PubChem (NCBI)