cas: 363-03-1 — see every product listed under this CAS number, including other names
Phenylquinone, 99.92% (CAS 363-03-1) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 5 g, 250 mg, 100 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W275039-1 g |
| cas | 363-03-1 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 454.37 Pln | |
| MedChemExpress | 5 g | 793.38 Pln | |
| MedChemExpress | 250 mg | 310.40 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 10mM/1mL | 250.03 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.92% |
2-phenylcyclohexa-2,5-diene-1,4-dione (CAS 363-03-1) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 2-phenylcyclohexa-2,5-diene-1,4-dione. InChIKey: RLQZIECDMISZHS-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-phenylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | RLQZIECDMISZHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C=CC2=O |
Computed by PubChem (NCBI)