cas: 363-03-1 — see every product listed under this CAS number, including other names
Phenyl-p-benzoquinone, 95% (CAS 363-03-1) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 417380250 |
| cas | 363-03-1 |
| size | 25g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 25g | 534.53 Pln | |
| Thermo Scientific (Acros) | 100g | 1349.70 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
2-phenylcyclohexa-2,5-diene-1,4-dione (CAS 363-03-1) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 2-phenylcyclohexa-2,5-diene-1,4-dione. InChIKey: RLQZIECDMISZHS-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-phenylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | RLQZIECDMISZHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C=CC2=O |
Computed by PubChem (NCBI)