CAS 363-03-1 appears in our catalog under these names: Phenyl-p-benzoquinone, 98%, 2-Phenyl-1,4-Benzoquinone, Phenylquinone, 2–Phenyl–1,4–benzoquinone, TFIIH Modulator-19/ 98.24% (existing batch purity). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, TargetMol. Available pack sizes: 5g, 1g, on request, 500mg, 10mg, 25mg, 50mg, 100mg.
2-phenylcyclohexa-2,5-diene-1,4-dione (CAS 363-03-1) is a chemical compound with the molecular formula C12H8O2 and a molecular weight of 184.19 g/mol. IUPAC name: 2-phenylcyclohexa-2,5-diene-1,4-dione. InChIKey: RLQZIECDMISZHS-UHFFFAOYSA-N.
| Molecular formula | C12H8O2 |
|---|---|
| Molecular weight | 184.19 g/mol |
| IUPAC name | 2-phenylcyclohexa-2,5-diene-1,4-dione |
| InChIKey | RLQZIECDMISZHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C=CC2=O |
Computed by PubChem (NCBI)