cas: 5332-24-1 — see every product listed under this CAS number, including other names
Quinoline, 3-bromo-, 98%, 98% (CAS 5332-24-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 5kg, 10kg, 25kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114J60-5g |
| cas | 5332-24-1 |
| size | 5g |
| availability | 25000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 122.00 Pln | |
| Chemat | 500g | 422.40 Pln | |
| Chemat | 5kg | 4008.00 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 25kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-bromoquinoline (CAS 5332-24-1) is a chemical compound with the molecular formula C9H6BrN and a molecular weight of 208.05 g/mol. IUPAC name: 3-bromoquinoline. InChIKey: ZGIKWINFUGEQEO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrN |
|---|---|
| Molecular weight | 208.05 g/mol |
| IUPAC name | 3-bromoquinoline |
| InChIKey | ZGIKWINFUGEQEO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)Br |
Computed by PubChem (NCBI)