Products 36950-96-6
CAS 36950-96-6 appears in our catalog under these names: Cicloprofen, cicloprofen/ 98.15% (existing batch purity), 2-(9H-Fluoren-2-yl)propanoic acid, 2-(9H-fluoren-2-yl)propanoic acid, 98.15% ,, 98.15% ,. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 250mg, 50mg, 1mg, 5mg, 25mg, 200mg.
2-(9H-fluoren-2-yl)propanoic acid (CAS 36950-96-6) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 2-(9H-fluoren-2-yl)propanoic acid. InChIKey: LRXFKKPEBXIPMW-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 2-(9H-fluoren-2-yl)propanoic acid |
| InChIKey | LRXFKKPEBXIPMW-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)C3=CC=CC=C3C2)C(=O)O |
Computed by PubChem (NCBI)