cas: 610-09-3 — see every product listed under this CAS number, including other names
cis-Cyclohexane-1,2-dicarboxylic acid (CAS 610-09-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242628-1G |
| cas | 610-09-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln |
| delivery time | 2-3 weeks |
|---|
Cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid (CAS 610-09-3) is a chemical compound with the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. IUPAC name: cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid. InChIKey: QSAWQNUELGIYBC-OLQVQODUSA-N.
| Molecular formula | C8H12O4 |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | cis-(1R,2S)-cyclohexane-1,2-dicarboxylic acid |
| InChIKey | QSAWQNUELGIYBC-OLQVQODUSA-N |
| SMILES | C1CC[C@@H]([C@@H](C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)