cas: 88574-06-5 — see every product listed under this CAS number, including other names
fmoc-E-acp-oh (CAS 88574-06-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045380-5G |
| cas | 88574-06-5 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 96.86 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 419.66 Pln | |
| Fluorochem | 500g | 1882.69 Pln |
| delivery time | 1-2 weeks |
|---|
6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid (CAS 88574-06-5) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid. InChIKey: FPCPONSZWYDXRD-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 6-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid |
| InChIKey | FPCPONSZWYDXRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCC(=O)O |
Computed by PubChem (NCBI)