Products 1000343-62-3
CAS 1000343-62-3 appears in our catalog under these names: Methyl 4-nitro-1H-indole-6-carboxylate 97+%, 4-NITRO-6-INDOLECARBOXYLIC ACID METHYL ESTER, 97+%, 97+%, 4-NITRO-6-INDOLECARBOXYLIC ACID METHYL ESTER, 97+%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 4-nitro-1H-indole-6-carboxylate (CAS 1000343-62-3) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: methyl 4-nitro-1H-indole-6-carboxylate. InChIKey: IFOFOPSZBXKRAG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | methyl 4-nitro-1H-indole-6-carboxylate |
| InChIKey | IFOFOPSZBXKRAG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=CN2)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)