Products 1000596-37-1
CAS 1000596-37-1 is the registry number for (R)-Hydroxymethylmexiletine Oxalate Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
[2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid (CAS 1000596-37-1) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: [2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid. InChIKey: VZVOJJXBPMAFQG-SBSPUUFOSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | [2-[(2R)-2-aminopropoxy]-3-methylphenyl]methanol;oxalic acid |
| InChIKey | VZVOJJXBPMAFQG-SBSPUUFOSA-N |
| SMILES | CC1=C(C(=CC=C1)CO)OC[C@@H](C)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)