Products 1824718-91-3

CAS 1824718-91-3 is the registry number for Heptanedioic acid 2,5-dioxo-pyrrolidin-1-yl ester ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl heptanedioate (CAS 1824718-91-3) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: 7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl heptanedioate. InChIKey: CFSGPBCOICZYDS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO6
Molecular weight285.29 g/mol
IUPAC name7-O-(2,5-dioxopyrrolidin-1-yl) 1-O-ethyl heptanedioate
InChIKeyCFSGPBCOICZYDS-UHFFFAOYSA-N
SMILESCCOC(=O)CCCCCC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)