Products 1055760-97-8
CAS 1055760-97-8 is the registry number for 7-((tert-Butoxy)carbonyl)-7-azabicyclo(2.2.1)heptane-2,3-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CAS 1055760-97-8) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: 7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-2,3-dicarboxylic acid. InChIKey: BLXZJROBTIMWKP-UHFFFAOYSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 7-[(2-methylpropan-2-yl)oxycarbonyl]-7-azabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| InChIKey | BLXZJROBTIMWKP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1C(C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)