CAS 57204-78-1 appears in our catalog under these names: N-Hydroxy mexiletine oxalate, 95%, N-Hydroxy Mexiletine Oxalate, N–(1–(2,6–Dimethylphenoxy)propan–2–yl)hydroxylamine oxalate, N-Hydroxy Mexiletine Oxalate, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 1g, 100mg, 250mg, 2,5mg, 25mg.
N-[1-(2,6-dimethylphenoxy)propan-2-yl]hydroxylamine;oxalic acid (CAS 57204-78-1) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: N-[1-(2,6-dimethylphenoxy)propan-2-yl]hydroxylamine;oxalic acid. InChIKey: PNGGHGAOQPZGES-UHFFFAOYSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | N-[1-(2,6-dimethylphenoxy)propan-2-yl]hydroxylamine;oxalic acid |
| InChIKey | PNGGHGAOQPZGES-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OCC(C)NO.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)