Products 4067-97-4
CAS 4067-97-4 is the registry number for L-a-Methyl-phenethylamine D-Tartrate. Offered by: TRC. Available pack sizes: 500mg.
(2S,3S)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine (CAS 4067-97-4) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: (2S,3S)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine. InChIKey: KHIBJQODXRPUJC-QGHJUCMSSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | (2S,3S)-2,3-dihydroxybutanedioic acid;(2S)-1-phenylpropan-2-amine |
| InChIKey | KHIBJQODXRPUJC-QGHJUCMSSA-N |
| SMILES | C[C@@H](CC1=CC=CC=C1)N.[C@H]([C@@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)