Products 1609637-03-7

CAS 1609637-03-7 is the registry number for 1-(2,5-Dioxopyrrolidin-1-yl) 8-methyl octanedioate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

8-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl octanedioate (CAS 1609637-03-7) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: 8-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl octanedioate. InChIKey: TZCDVIBUNGOBJM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19NO6
Molecular weight285.29 g/mol
IUPAC name8-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl octanedioate
InChIKeyTZCDVIBUNGOBJM-UHFFFAOYSA-N
SMILESCOC(=O)CCCCCCC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)