Products 3050984-63-6
CAS 3050984-63-6 appears in our catalog under these names: 6-tert-butoxycarbonyl-6-azabicyclo[3.1.1]heptane-3,3-dicarboxylic acid, 95%, 6-tert-butoxycarbonyl-6-azabicyclo[3.1.1]heptane-3,3-dicarboxylic acid, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azabicyclo[3.1.1]heptane-3,3-dicarboxylic acid (CAS 3050984-63-6) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: 6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azabicyclo[3.1.1]heptane-3,3-dicarboxylic acid. InChIKey: PTOXZFNFSKOGCI-UHFFFAOYSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 6-[(2-methylpropan-2-yl)oxycarbonyl]-6-azabicyclo[3.1.1]heptane-3,3-dicarboxylic acid |
| InChIKey | PTOXZFNFSKOGCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CC1CC(C2)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)