Products 1330264-84-0
CAS 1330264-84-0 appears in our catalog under these names: N-Hydroxy Mexiletine-d6 Oxalate, >95% (HPLC), N-Hydroxy Mexiletine-d6 Oxalate. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
N-[1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-yl]hydroxylamine;oxalic acid (CAS 1330264-84-0) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 291.33 g/mol. IUPAC name: N-[1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-yl]hydroxylamine;oxalic acid. InChIKey: PNGGHGAOQPZGES-SJPQGYSLSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 291.33 g/mol |
| IUPAC name | N-[1,1,1,2,3,3-hexadeuterio-3-(2,6-dimethylphenoxy)propan-2-yl]hydroxylamine;oxalic acid |
| InChIKey | PNGGHGAOQPZGES-SJPQGYSLSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])OC1=C(C=CC=C1C)C)NO.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)