Products 1177292-01-1
CAS 1177292-01-1 is the registry number for 2-Amino-2-(4-isopropoxyphenyl)ethanol oxalate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-amino-2-(4-propan-2-yloxyphenyl)ethanol;oxalic acid (CAS 1177292-01-1) is a chemical compound with the molecular formula C13H19NO6 and a molecular weight of 285.29 g/mol. IUPAC name: 2-amino-2-(4-propan-2-yloxyphenyl)ethanol;oxalic acid. InChIKey: AUKPMFIDAABLPI-UHFFFAOYSA-N.
| Molecular formula | C13H19NO6 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | 2-amino-2-(4-propan-2-yloxyphenyl)ethanol;oxalic acid |
| InChIKey | AUKPMFIDAABLPI-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C(CO)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)