CAS 1000933-82-3 appears in our catalog under these names: 2-(chloromethyl)-5,6-dimethylfuro(2,3-d)pyrimidin-4-amine, 98%, 2-(Chloromethyl)-5,6-dimethylfuro(2,3-d)pyrimidin-4-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.
2-(chloromethyl)-5,6-dimethylfuro[2,3-d]pyrimidin-4-amine (CAS 1000933-82-3) is a chemical compound with the molecular formula C9H10ClN3O and a molecular weight of 211.65 g/mol. IUPAC name: 2-(chloromethyl)-5,6-dimethylfuro[2,3-d]pyrimidin-4-amine. InChIKey: RQUUBPZEGDZSNS-UHFFFAOYSA-N.
| Molecular formula | C9H10ClN3O |
|---|---|
| Molecular weight | 211.65 g/mol |
| IUPAC name | 2-(chloromethyl)-5,6-dimethylfuro[2,3-d]pyrimidin-4-amine |
| InChIKey | RQUUBPZEGDZSNS-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=NC(=NC(=C12)N)CCl)C |
Computed by PubChem (NCBI)