CAS 100538-35-0 appears in our catalog under these names: 2-(3-Formylphenyl)benzoic acid, 95%, 3'-Formyl-(1,1'-biphenyl)-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 10g.
2-(3-formylphenyl)benzoic acid (CAS 100538-35-0) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 2-(3-formylphenyl)benzoic acid. InChIKey: ZNULJIUYCWDSRX-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 2-(3-formylphenyl)benzoic acid |
| InChIKey | ZNULJIUYCWDSRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=CC(=C2)C=O)C(=O)O |
Computed by PubChem (NCBI)