CAS 101084-61-1 is the registry number for 3-METHYL-6-NITRO-2,3-DIHYDRO-1,3-BENZOXAZOL-2-ONE, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-6-nitro-1,3-benzoxazol-2-one (CAS 101084-61-1) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 3-methyl-6-nitro-1,3-benzoxazol-2-one. InChIKey: VUKIKMHYSUVLQB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 3-methyl-6-nitro-1,3-benzoxazol-2-one |
| InChIKey | VUKIKMHYSUVLQB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])OC1=O |
Computed by PubChem (NCBI)