CAS 132522-81-7 appears in our catalog under these names: 5-Nitro-2h-1,4-benzoxazin-3(4h)-one, 95%, 5-Nitro-2H-benzo(b)(1,4)oxazin-3(4H)-one, 95+%, 5-Nitro-2H-1,4-benzoxazin-3(4H)-one, 95%+, 95%+. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-nitro-4H-1,4-benzoxazin-3-one (CAS 132522-81-7) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 5-nitro-4H-1,4-benzoxazin-3-one. InChIKey: MJMKRYIJNBIITM-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 5-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | MJMKRYIJNBIITM-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(C=CC=C2O1)[N+](=O)[O-] |
Computed by PubChem (NCBI)