Products 1248961-95-6
CAS 1248961-95-6 is the registry number for 2-(Isoxazol-3-yl)-5-methyloxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-2-(1,2-oxazol-3-yl)-1,3-oxazole-4-carboxylic acid (CAS 1248961-95-6) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 5-methyl-2-(1,2-oxazol-3-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: JKSACRIQYVMHTQ-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 5-methyl-2-(1,2-oxazol-3-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | JKSACRIQYVMHTQ-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=NOC=C2)C(=O)O |
Computed by PubChem (NCBI)