CAS 112429-42-2 is the registry number for 3-Methyl-7-nitrobenzo[d]isoxazol-6-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
3-methyl-7-nitro-1,2-benzoxazol-6-ol (CAS 112429-42-2) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 3-methyl-7-nitro-1,2-benzoxazol-6-ol. InChIKey: JLAOOOJONJCBFE-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 3-methyl-7-nitro-1,2-benzoxazol-6-ol |
| InChIKey | JLAOOOJONJCBFE-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C=CC(=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)