CAS 39830-63-2 is the registry number for 3-Hydroxy-4-nitroisoindolin-1-one, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-4-nitro-2,3-dihydroisoindol-1-one (CAS 39830-63-2) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 3-hydroxy-4-nitro-2,3-dihydroisoindol-1-one. InChIKey: KOBKMLXDYFODDD-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 3-hydroxy-4-nitro-2,3-dihydroisoindol-1-one |
| InChIKey | KOBKMLXDYFODDD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(NC2=O)O)C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)