CAS 1379208-77-1 is the registry number for Gefitinib Impurity 46. Offered by: Chemat Brand. Available pack sizes: on request.
5-hydroxy-4-methoxy-2-nitrobenzonitrile (CAS 1379208-77-1) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 5-hydroxy-4-methoxy-2-nitrobenzonitrile. InChIKey: KRTAIUJRTKNODL-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 5-hydroxy-4-methoxy-2-nitrobenzonitrile |
| InChIKey | KRTAIUJRTKNODL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)[N+](=O)[O-])C#N)O |
Computed by PubChem (NCBI)