Products 2055119-38-3

CAS 2055119-38-3 is the registry number for 2-Amino-6-hydroxy-1,3-benzoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-amino-6-hydroxy-1,3-benzoxazole-5-carboxylic acid (CAS 2055119-38-3) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 2-amino-6-hydroxy-1,3-benzoxazole-5-carboxylic acid. InChIKey: VUOMXEBQVDHRFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6N2O4
Molecular weight194.14 g/mol
IUPAC name2-amino-6-hydroxy-1,3-benzoxazole-5-carboxylic acid
InChIKeyVUOMXEBQVDHRFQ-UHFFFAOYSA-N
SMILESC1=C(C(=CC2=C1N=C(O2)N)O)C(=O)O

Computed by PubChem (NCBI)