CAS 337463-89-5 appears in our catalog under these names: 3-Oxo-3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine-6-carboxylic acid, 98%, 3-Oxo-3,4-dihydro-2H-pyrido(3,2-b)(1,4)oxazine-6-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
3-oxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxylic acid (CAS 337463-89-5) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxylic acid. InChIKey: GJSZXSXYEKSOAN-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 3-oxo-4H-pyrido[3,2-b][1,4]oxazine-6-carboxylic acid |
| InChIKey | GJSZXSXYEKSOAN-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC(=N2)C(=O)O |
Computed by PubChem (NCBI)