CAS 81721-86-0 appears in our catalog under these names: 7-Nitro-2H-1,4-benzoxazin-3(4H)-one, 97%, 7-Nitro-2H-benzo[b][1,4]oxazin-3(4H)-one 98%, 7-Nitro-2H-Benzo[B][1,4]Oxazin-3(4H)-One, 95%, 95%, 7-Nitro-4H-benzo[1,4]oxazin-3-one, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 100mg, 250mg, 500g.
7-nitro-4H-1,4-benzoxazin-3-one (CAS 81721-86-0) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: 7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: YVGHCFMAEHXPBH-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | 7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | YVGHCFMAEHXPBH-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)