CAS 10129-78-9 appears in our catalog under these names: 2,4-Dibromophenoxyacetic acid, 95%, 2-(2,4-Dibromophenoxy)acetic acid, 95+%, (2,4-Dibromophenoxy)acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 5g, 10g, 1g, 20g.
2-(2,4-dibromophenoxy)acetic acid (CAS 10129-78-9) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2-(2,4-dibromophenoxy)acetic acid. InChIKey: LIIAWXHMVYLFGT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2-(2,4-dibromophenoxy)acetic acid |
| InChIKey | LIIAWXHMVYLFGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)Br)OCC(=O)O |
Computed by PubChem (NCBI)