CAS 24744-58-9 appears in our catalog under these names: 2-(3,5-Dibromo-4-hydroxyphenyl)acetic acid, 95%, 2–(3,5–Dibromo–4–hydroxyphenyl)acetic acid, 2-(3,5-Dibromo-4-hydroxyphenyl)acetic acid, 95%, 95%, 3,5-DIBROMO-4-HYDROXYPHENYLACETIC ACID, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-(3,5-dibromo-4-hydroxyphenyl)acetic acid (CAS 24744-58-9) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2-(3,5-dibromo-4-hydroxyphenyl)acetic acid. InChIKey: WZHLZXHHXUHDDU-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2-(3,5-dibromo-4-hydroxyphenyl)acetic acid |
| InChIKey | WZHLZXHHXUHDDU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)CC(=O)O |
Computed by PubChem (NCBI)