Products 121789-22-8

CAS 121789-22-8 is the registry number for 2,4-Dibromo-5-methoxybenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,4-dibromo-5-methoxybenzoic acid (CAS 121789-22-8) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2,4-dibromo-5-methoxybenzoic acid. InChIKey: JQZKHMIOHWNCFI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2O3
Molecular weight309.94 g/mol
IUPAC name2,4-dibromo-5-methoxybenzoic acid
InChIKeyJQZKHMIOHWNCFI-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)O)Br)Br

Computed by PubChem (NCBI)