Products 1214366-13-8
CAS 1214366-13-8 is the registry number for 2-(2,6-Dibromophenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dibromophenyl)-2-hydroxyacetic acid (CAS 1214366-13-8) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2-(2,6-dibromophenyl)-2-hydroxyacetic acid. InChIKey: RGBVYIQQRRITTI-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2-(2,6-dibromophenyl)-2-hydroxyacetic acid |
| InChIKey | RGBVYIQQRRITTI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)C(C(=O)O)O)Br |
Computed by PubChem (NCBI)