Products 2091763-16-3
CAS 2091763-16-3 appears in our catalog under these names: 2,6-Dibromo-3-methoxybenzoic acid, 2,6-Dibromo-3-methoxybenzoic acid, 95%, 2,6-Dibromo-3-methoxybenzoic acid, 98%, 2,6-Dibromo-3-methoxybenzoic acid, ≥95%, ≥95%. Offered by: Fluorochem, Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
2,6-dibromo-3-methoxybenzoic acid (CAS 2091763-16-3) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2,6-dibromo-3-methoxybenzoic acid. InChIKey: BPAQWEGHXZSDKT-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2,6-dibromo-3-methoxybenzoic acid |
| InChIKey | BPAQWEGHXZSDKT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)