CAS 1214384-63-0 is the registry number for 2-(3,5-Dibromophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,5-dibromophenyl)-2-hydroxyacetic acid (CAS 1214384-63-0) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2-(3,5-dibromophenyl)-2-hydroxyacetic acid. InChIKey: KCIKDTRXKWRSNU-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2-(3,5-dibromophenyl)-2-hydroxyacetic acid |
| InChIKey | KCIKDTRXKWRSNU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)C(C(=O)O)O |
Computed by PubChem (NCBI)