Products 1214384-63-0

CAS 1214384-63-0 is the registry number for 2-(3,5-Dibromophenyl)-2-hydroxyacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(3,5-dibromophenyl)-2-hydroxyacetic acid (CAS 1214384-63-0) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2-(3,5-dibromophenyl)-2-hydroxyacetic acid. InChIKey: KCIKDTRXKWRSNU-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2O3
Molecular weight309.94 g/mol
IUPAC name2-(3,5-dibromophenyl)-2-hydroxyacetic acid
InChIKeyKCIKDTRXKWRSNU-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Br)Br)C(C(=O)O)O

Computed by PubChem (NCBI)