CAS 2973-75-3 appears in our catalog under these names: 2,3-Dibromo-4-hydroxy-5-methoxybenzaldehyde, 95%, 2,3-Dibromo-4-hydroxy-5-methoxybenzaldehyde, 95+%, 5,6-Dibromovanillin, 2,3-Dibromo-4-hydroxy-5-methoxybenzaldehyde, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100g, 50g, 250g.
2,3-dibromo-4-hydroxy-5-methoxybenzaldehyde (CAS 2973-75-3) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2,3-dibromo-4-hydroxy-5-methoxybenzaldehyde. InChIKey: WKLKGSHBXNPUDU-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O3 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2,3-dibromo-4-hydroxy-5-methoxybenzaldehyde |
| InChIKey | WKLKGSHBXNPUDU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)Br)Br)O |
Computed by PubChem (NCBI)