Products 871944-17-1

CAS 871944-17-1 is the registry number for 2-(2,4-Dibromophenyl)-2-hydroxyacetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

2-(2,4-dibromophenyl)-2-hydroxyacetic acid (CAS 871944-17-1) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: 2-(2,4-dibromophenyl)-2-hydroxyacetic acid. InChIKey: OBPLXKUUFCJMAD-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2O3
Molecular weight309.94 g/mol
IUPAC name2-(2,4-dibromophenyl)-2-hydroxyacetic acid
InChIKeyOBPLXKUUFCJMAD-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)Br)C(C(=O)O)O

Computed by PubChem (NCBI)