Products 2086270-88-2

CAS 2086270-88-2 is the registry number for 4,5-Dibromo-2-hydroxy-benzoic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4,5-dibromo-2-hydroxybenzoate (CAS 2086270-88-2) is a chemical compound with the molecular formula C8H6Br2O3 and a molecular weight of 309.94 g/mol. IUPAC name: methyl 4,5-dibromo-2-hydroxybenzoate. InChIKey: BJLWBOLNFVFHKL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6Br2O3
Molecular weight309.94 g/mol
IUPAC namemethyl 4,5-dibromo-2-hydroxybenzoate
InChIKeyBJLWBOLNFVFHKL-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC(=C(C=C1O)Br)Br

Computed by PubChem (NCBI)