CAS 10136-64-8 is the registry number for 6-Phenylimidazo(2,1-b)(1,3,4)thiadiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine (CAS 10136-64-8) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine. InChIKey: URINLJMMDZLYSE-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-amine |
| InChIKey | URINLJMMDZLYSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C(=N2)SC(=N3)N |
Computed by PubChem (NCBI)