CAS 29219-43-0 appears in our catalog under these names: 1-(Benzo(d)thiazol-2-yl)-1H-pyrazol-5-amine, 97%, 1–(Benzo(d)thiazol–2–yl)–1H–pyrazol–5–amine. Offered by: AmBeed, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
2-(1,3-benzothiazol-2-yl)pyrazol-3-amine (CAS 29219-43-0) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-(1,3-benzothiazol-2-yl)pyrazol-3-amine. InChIKey: KBFPXKLPVGTJLI-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-(1,3-benzothiazol-2-yl)pyrazol-3-amine |
| InChIKey | KBFPXKLPVGTJLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)N3C(=CC=N3)N |
Computed by PubChem (NCBI)