CAS 258350-62-8 is the registry number for 2-Methyl[1,2,4]triazolo[1,5-c]quinazoline-5-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-methyl-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione (CAS 258350-62-8) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-methyl-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione. InChIKey: OHYMWNARIQBYDT-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-methyl-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione |
| InChIKey | OHYMWNARIQBYDT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C3C=CC=CC3=NC(=S)N2N1 |
Computed by PubChem (NCBI)