CAS 875160-35-3 appears in our catalog under these names: 2-Methyl-1h,5h-[1,2,4]triazolo[1,5-c]quinazoline-5-thione, 95%, 2-Methyl-(1,2,4)triazolo(1,5-c)quinazoline-5(1H)-thione, 98%, 2-Methyl-1H,5H-(1,2,4)triazolo(1,5-c)quinazoline-5-thione. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-methyl-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione (CAS 875160-35-3) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-methyl-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione. InChIKey: OHYMWNARIQBYDT-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-methyl-3H-[1,2,4]triazolo[1,5-c]quinazoline-5-thione |
| InChIKey | OHYMWNARIQBYDT-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C3C=CC=CC3=NC(=S)N2N1 |
Computed by PubChem (NCBI)