Products 904817-81-8
CAS 904817-81-8 is the registry number for 2-(Thiophen-2-yl)imidazo(1,2-a)pyrimidin-3-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
2-thiophen-2-ylimidazo[1,2-a]pyrimidin-3-amine (CAS 904817-81-8) is a chemical compound with the molecular formula C10H8N4S and a molecular weight of 216.26 g/mol. IUPAC name: 2-thiophen-2-ylimidazo[1,2-a]pyrimidin-3-amine. InChIKey: ILBJBKAVDGYVEI-UHFFFAOYSA-N.
| Molecular formula | C10H8N4S |
|---|---|
| Molecular weight | 216.26 g/mol |
| IUPAC name | 2-thiophen-2-ylimidazo[1,2-a]pyrimidin-3-amine |
| InChIKey | ILBJBKAVDGYVEI-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(N=C2N=C1)C3=CC=CS3)N |
Computed by PubChem (NCBI)